What is the molecular formula of 3,5-Dibromo-4-nitropyridine-N-oxide?
The molecular formula is C5H2Br2N2O3.
What are the synonyms for 3,5-Dibromo-4-nitropyridine-N-oxide?
The synonyms include 62516-09-0, 3,5-Dibromo-4-nitropyridine-n-oxide, 3,5-Dibromo-4-nitropyridine 1-oxide, and 3,5-dibromo-4-nitro-1-oxidopyridin-1-ium.
What is the molecular weight of 3,5-Dibromo-4-nitropyridine-N-oxide?
The molecular weight is 297.89 g/mol.
When was 3,5-Dibromo-4-nitropyridine-N-oxide created in PubChem?
It was created on July 19, 2005.
When was 3,5-Dibromo-4-nitropyridine-N-oxide last modified in PubChem?
It was last modified on December 2, 2023.
What is the IUPAC name of 3,5-Dibromo-4-nitropyridine-N-oxide?
The IUPAC name is 3,5-dibromo-4-nitro-1-oxidopyridin-1-ium.
What is the InChI of 3,5-Dibromo-4-nitropyridine-N-oxide?
The InChI is InChI=1S/C5H2Br2N2O3/c6-3-1-8(10)2-4(7)5(3)9(11)12/h1-2H.
What is the InChIKey of 3,5-Dibromo-4-nitropyridine-N-oxide?
The InChIKey is MNPIOSXHEAIODW-UHFFFAOYSA-N.
What is the canonical SMILES of 3,5-Dibromo-4-nitropyridine-N-oxide?
The canonical SMILES is C1=C(C(=C(C=[N+]1[O-])Br)[N+](=O)[O-])Br.
What is the CAS number of 3,5-Dibromo-4-nitropyridine-N-oxide?
The CAS number is 62516-09-0.
※ Please kindly note that our products are for research use only.