What is the PubChem CID of 3,5-Dibromo-2-aminobenzaldehyde?
PubChem CID of 3,5-Dibromo-2-aminobenzaldehyde is 688305.
What is the molecular formula of 3,5-Dibromo-2-aminobenzaldehyde?
The molecular formula of 3,5-Dibromo-2-aminobenzaldehyde is C7H5Br2NO.
What is the molecular weight of 3,5-Dibromo-2-aminobenzaldehyde?
The molecular weight of 3,5-Dibromo-2-aminobenzaldehyde is 278.93 g/mol.
What are the synonyms of 3,5-Dibromo-2-aminobenzaldehyde?
The synonyms of 3,5-Dibromo-2-aminobenzaldehyde include 2-Amino-3,5-dibromobenzaldehyde, 50910-55-9, 2-amino-3,5-dibromo-benzaldehyde, and 3,5-DIBROMO-2-AMINOBENZALDEHYDE.
What is the IUPAC name of 3,5-Dibromo-2-aminobenzaldehyde?
The IUPAC name of 3,5-Dibromo-2-aminobenzaldehyde is 2-amino-3,5-dibromobenzaldehyde.
What is the InChI of 3,5-Dibromo-2-aminobenzaldehyde?
The InChI of 3,5-Dibromo-2-aminobenzaldehyde is InChI=1S/C7H5Br2NO/c8-5-1-4(3-11)7(10)6(9)2-5/h1-3H,10H2.
What is the InChIKey of 3,5-Dibromo-2-aminobenzaldehyde?
The InChIKey of 3,5-Dibromo-2-aminobenzaldehyde is RCPAZWISSAVDEA-UHFFFAOYSA-N.
What is the Canonical SMILES of 3,5-Dibromo-2-aminobenzaldehyde?
The Canonical SMILES of 3,5-Dibromo-2-aminobenzaldehyde is C1=C(C=C(C(=C1C=O)N)Br)Br.
What is the CAS number of 3,5-Dibromo-2-aminobenzaldehyde?
The CAS number of 3,5-Dibromo-2-aminobenzaldehyde is 50910-55-9.
What is the XLogP3-AA value of 3,5-Dibromo-2-aminobenzaldehyde?
The XLogP3-AA value of 3,5-Dibromo-2-aminobenzaldehyde is 2.6.
※ Please kindly note that our products are for research use only.