What is the molecular formula of 3,5-Bis(1,1-dimethylethyl)-4-hydroxybenzenepropanoic acid thiodi-2,1-ethanediyl ester?
The molecular formula is C38H58O6S.
What is the molecular weight of 3,5-Bis(1,1-dimethylethyl)-4-hydroxybenzenepropanoic acid thiodi-2,1-ethanediyl ester?
The molecular weight is 642.9 g/mol.
What is the IUPAC name of the compound?
The IUPAC name is 2-[2-[3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoyloxy]ethylsulfanyl]ethyl 3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoate.
What is the InChI of 3,5-Bis(1,1-dimethylethyl)-4-hydroxybenzenepropanoic acid thiodi-2,1-ethanediyl ester?
The InChI is InChI=1S/C38H58O6S/c1-35(2,3)27-21-25(22-28(33(27)41)36(4,5)6)13-15-31(39)43-17-19-45-20-18-44-32(40)16-14-26-23-29(37(7,8)9)34(42)30(24-26)38(10,11)12/h21-24,41-42H,13-20H2,1-12H3.
What is the InChIKey of 3,5-Bis(1,1-dimethylethyl)-4-hydroxybenzenepropanoic acid thiodi-2,1-ethanediyl ester?
The InChIKey is VFBJXXJYHWLXRM-UHFFFAOYSA-N.
What is the canonical SMILES of the compound?
The canonical SMILES is CC(C)(C)C1=CC(=CC(=C1O)C(C)(C)C)CCC(=O)OCCSCCOC(=O)CCC2=CC(=C(C(=C2)C(C)(C)C)O)C(C)(C)C.
What is the CAS number of 3,5-Bis(1,1-dimethylethyl)-4-hydroxybenzenepropanoic acid thiodi-2,1-ethanediyl ester?
The CAS number is 41484-35-9.
What is the UNII of the compound?
The UNII is 6F5OZW34JZ.
What is the XLogP3-AA of 3,5-Bis(1,1-dimethylethyl)-4-hydroxybenzenepropanoic acid thiodi-2,1-ethanediyl ester?
The XLogP3-AA is 10.4.
How many hydrogen bond donor and acceptor counts does the compound have?
The compound has 2 hydrogen bond donor counts and 7 hydrogen bond acceptor counts.
※ Please kindly note that our products are for research use only.