--- Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of vanilpyruvic acid is C10H10O5.
Some synonyms of vanilpyruvic acid are 4-Hydroxy-3-methoxyphenylpyruvic acid and Vanylpyruvic acid.
The molecular weight of vanilpyruvic acid is 210.18 g/mol.
The IUPAC name of vanilpyruvic acid is 3-(4-hydroxy-3-methoxyphenyl)-2-oxopropanoic acid.
The InChIKey of vanilpyruvic acid is YGQHQTMRZPHIBB-UHFFFAOYSA-N.
The canonical SMILES representation of vanilpyruvic acid is COC1=C(C=CC(=C1)CC(=O)C(=O)O).
Vanilpyruvic acid has 2 hydrogen bond donor counts.
The topological polar surface area of vanilpyruvic acid is 83.8Ų.
The exact mass and monoisotopic mass of vanilpyruvic acid are 210.05282342 g/mol.
The complexity of vanilpyruvic acid is 250.
Download
×