What is the PubChem CID for 3,4-Dihydroxy-1-butene?
PubChem CID for 3,4-Dihydroxy-1-butene is 10338.
What is the molecular formula of 3,4-Dihydroxy-1-butene?
The molecular formula of 3,4-Dihydroxy-1-butene is C4H8O2.
What is the molecular weight of 3,4-Dihydroxy-1-butene?
The molecular weight of 3,4-Dihydroxy-1-butene is 88.11 g/mol.
What is the IUPAC name of 3,4-Dihydroxy-1-butene?
The IUPAC name of 3,4-Dihydroxy-1-butene is but-3-ene-1,2-diol.
What is the InChI of 3,4-Dihydroxy-1-butene?
The InChI of 3,4-Dihydroxy-1-butene is InChI=1S/C4H8O2/c1-2-4(6)3-5/h2,4-6H,1,3H2.
What is the InChIKey of 3,4-Dihydroxy-1-butene?
The InChIKey of 3,4-Dihydroxy-1-butene is ITMIAZBRRZANGB-UHFFFAOYSA-N.
What is the canonical SMILES of 3,4-Dihydroxy-1-butene?
The canonical SMILES of 3,4-Dihydroxy-1-butene is C=CC(CO)O.
What is the CAS number of 3,4-Dihydroxy-1-butene?
The CAS number of 3,4-Dihydroxy-1-butene is 497-06-3.
What is the XLogP3-AA value of 3,4-Dihydroxy-1-butene?
The XLogP3-AA value of 3,4-Dihydroxy-1-butene is -0.5.
Is 3,4-Dihydroxy-1-butene a canonicalized compound?
Yes, 3,4-Dihydroxy-1-butene is a canonicalized compound.