What is the molecular formula of 3,4-Difluoro-5-(trifluoromethyl)benzyl bromide?
The molecular formula is C8H4BrF5.
What is the molecular weight of 3,4-Difluoro-5-(trifluoromethyl)benzyl bromide?
The molecular weight is 275.01 g/mol.
What is the IUPAC name of 3,4-Difluoro-5-(trifluoromethyl)benzyl bromide?
The IUPAC name is 5-(bromomethyl)-1,2-difluoro-3-(trifluoromethyl)benzene.
What is the InChI of 3,4-Difluoro-5-(trifluoromethyl)benzyl bromide?
The InChI is InChI=1S/C8H4BrF5/c9-3-4-1-5(8(12,13)14)7(11)6(10)2-4/h1-2H,3H2.
What is the InChIKey of 3,4-Difluoro-5-(trifluoromethyl)benzyl bromide?
The InChIKey is ARGQEGUGAFKWBO-UHFFFAOYSA-N.
What is the Canonical SMILES of 3,4-Difluoro-5-(trifluoromethyl)benzyl bromide?
The Canonical SMILES is C1=C(C=C(C(=C1C(F)(F)F)F)F)CBr.
What is the CAS number of 3,4-Difluoro-5-(trifluoromethyl)benzyl bromide?
The CAS number is 239079-92-6.
What is the XLogP3-AA value of 3,4-Difluoro-5-(trifluoromethyl)benzyl bromide?
The XLogP3-AA value is 3.6.
How many hydrogen bond donor counts does 3,4-Difluoro-5-(trifluoromethyl)benzyl bromide have?
It has 0 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does 3,4-Difluoro-5-(trifluoromethyl)benzyl bromide have?
It has 5 hydrogen bond acceptor counts.