What is the molecular formula of 3,4-Diethoxyphenylamine?
The molecular formula of 3,4-Diethoxyphenylamine is C10H15NO2.
What is the molecular weight of 3,4-Diethoxyphenylamine?
The molecular weight of 3,4-Diethoxyphenylamine is 181.23 g/mol.
What is the IUPAC name of 3,4-Diethoxyphenylamine?
The IUPAC name of 3,4-Diethoxyphenylamine is 3,4-diethoxyaniline.
What is the InChI of 3,4-Diethoxyphenylamine?
The InChI of 3,4-Diethoxyphenylamine is InChI=1S/C10H15NO2/c1-3-12-9-6-5-8(11)7-10(9)13-4-2/h5-7H,3-4,11H2,1-2H3.
What is the InChIKey of 3,4-Diethoxyphenylamine?
The InChIKey of 3,4-Diethoxyphenylamine is IKYZLUAAOLUOFW-UHFFFAOYSA-N.
What is the canonical SMILES of 3,4-Diethoxyphenylamine?
The canonical SMILES of 3,4-Diethoxyphenylamine is CCOC1=C(C=C(C=C1)N)OCC.
What is the CAS number of 3,4-Diethoxyphenylamine?
The CAS number of 3,4-Diethoxyphenylamine is 39052-12-5.
What is the European Community (EC) number of 3,4-Diethoxyphenylamine?
The European Community (EC) number of 3,4-Diethoxyphenylamine is 826-571-3.
What is the DSSTox Substance ID of 3,4-Diethoxyphenylamine?
The DSSTox Substance ID of 3,4-Diethoxyphenylamine is DTXSID00334498.
Is 3,4-Diethoxyphenylamine a canonicalized compound?
Yes, 3,4-Diethoxyphenylamine is a canonicalized compound according to PubChem.