What is the molecular formula of 3,4-Dichlorobromobenzene?
The molecular formula of 3,4-Dichlorobromobenzene is C6H3BrCl2.
What is the molecular weight of 3,4-Dichlorobromobenzene?
The molecular weight of 3,4-Dichlorobromobenzene is 225.89 g/mol.
What is the IUPAC name of 3,4-Dichlorobromobenzene?
The IUPAC name of 3,4-Dichlorobromobenzene is 4-bromo-1,2-dichlorobenzene.
What is the InChI of 3,4-Dichlorobromobenzene?
The InChI of 3,4-Dichlorobromobenzene is InChI=1S/C6H3BrCl2/c7-4-1-2-5(8)6(9)3-4/h1-3H.
What is the InChIKey of 3,4-Dichlorobromobenzene?
The InChIKey of 3,4-Dichlorobromobenzene is CFPZDVAZISWERM-UHFFFAOYSA-N.
What is the canonical SMILES of 3,4-Dichlorobromobenzene?
The canonical SMILES of 3,4-Dichlorobromobenzene is C1=CC(=C(C=C1Br)Cl)Cl.
What is the CAS number of 3,4-Dichlorobromobenzene?
The CAS number of 3,4-Dichlorobromobenzene is 18282-59-2.
What is the EC number of 3,4-Dichlorobromobenzene?
The EC number of 3,4-Dichlorobromobenzene is 242-160-6.
What is the UNII of 3,4-Dichlorobromobenzene?
The UNII of 3,4-Dichlorobromobenzene is XE64D7GD53.
Is 3,4-Dichlorobromobenzene a canonicalized compound?
Yes, 3,4-Dichlorobromobenzene is a canonicalized compound.