What is the molecular formula of 3,4-Dibromotoluene?
The molecular formula of 3,4-Dibromotoluene is C7H6Br2.
What is the molecular weight of 3,4-Dibromotoluene?
The molecular weight of 3,4-Dibromotoluene is 249.93 g/mol.
What is the IUPAC name of 3,4-Dibromotoluene?
The IUPAC name of 3,4-Dibromotoluene is 1,2-dibromo-4-methylbenzene.
What is the InChI of 3,4-Dibromotoluene?
The InChI of 3,4-Dibromotoluene is InChI=1S/C7H6Br2/c1-5-2-3-6(8)7(9)4-5/h2-4H,1H3.
What is the InChIKey of 3,4-Dibromotoluene?
The InChIKey of 3,4-Dibromotoluene is LDCPXNOCWDGYIU-UHFFFAOYSA-N.
What is the CAS number of 3,4-Dibromotoluene?
The CAS number of 3,4-Dibromotoluene is 60956-23-2.
What is the XLogP3-AA value of 3,4-Dibromotoluene?
The XLogP3-AA value of 3,4-Dibromotoluene is 3.7.
How many hydrogen bond donor counts does 3,4-Dibromotoluene have?
3,4-Dibromotoluene has 0 hydrogen bond donor counts.
How many rotatable bond counts does 3,4-Dibromotoluene have?
3,4-Dibromotoluene has 0 rotatable bond counts.
Is 3,4-Dibromotoluene a canonicalized compound?
Yes, 3,4-Dibromotoluene is a canonicalized compound.