What is the molecular formula of 3,4,5-Trihydroxybenzaldehyde?
The molecular formula of 3,4,5-Trihydroxybenzaldehyde is C7H6O4.
What are the synonyms for 3,4,5-Trihydroxybenzaldehyde?
The synonyms for 3,4,5-Trihydroxybenzaldehyde are Gallic aldehyde, Gallaldehyde, and benzaldehyde, 3,4,5-trihydroxy.
What is the molecular weight of 3,4,5-Trihydroxybenzaldehyde?
The molecular weight of 3,4,5-Trihydroxybenzaldehyde is 154.12 g/mol.
When was 3,4,5-Trihydroxybenzaldehyde created?
3,4,5-Trihydroxybenzaldehyde was created on March 26, 2005.
In which organisms can 3,4,5-Trihydroxybenzaldehyde be found?
3,4,5-Trihydroxybenzaldehyde can be found in Streptomyces lincolnensis, Geum japonicum, and other organisms with available data.
What is the IUPAC name of 3,4,5-Trihydroxybenzaldehyde?
The IUPAC name of 3,4,5-Trihydroxybenzaldehyde is 3,4,5-trihydroxybenzaldehyde.
What is the InChI of 3,4,5-Trihydroxybenzaldehyde?
The InChI of 3,4,5-Trihydroxybenzaldehyde is InChI=1S/C7H6O4/c8-3-4-1-5(9)7(11)6(10)2-4/h1-3,9-11H.
What is the InChIKey of 3,4,5-Trihydroxybenzaldehyde?
The InChIKey of 3,4,5-Trihydroxybenzaldehyde is RGZHEOWNTDJLAQ-UHFFFAOYSA-N.
What is the CAS number of 3,4,5-Trihydroxybenzaldehyde?
The CAS number of 3,4,5-Trihydroxybenzaldehyde is 13677-79-7.
What is the XLogP3 value of 3,4,5-Trihydroxybenzaldehyde?
The XLogP3 value of 3,4,5-Trihydroxybenzaldehyde is 0.6.