What is the molecular formula of 3,4,5-Tribromobiphenyl?
The molecular formula is C12H7Br3.
What is the molecular weight of 3,4,5-Tribromobiphenyl?
The molecular weight is 390.90 g/mol.
What is the IUPAC name of 3,4,5-Tribromobiphenyl?
The IUPAC name is 1,2,3-tribromo-5-phenylbenzene.
What is the InChI key of 3,4,5-Tribromobiphenyl?
The InChI key is GHSQRJGOIOSWQL-UHFFFAOYSA-N.
What is the canonical SMILES of 3,4,5-Tribromobiphenyl?
The canonical SMILES is C1=CC=C(C=C1)C2=CC(=C(C(=C2)Br)Br)Br.
What is the CAS number of 3,4,5-Tribromobiphenyl?
The CAS number is 115245-08-4.
What is the UNII of 3,4,5-Tribromobiphenyl?
The UNII is 6070ZMQ9A7.
What is the XLogP3-AA value of 3,4,5-Tribromobiphenyl?
The XLogP3-AA value is 5.6.
What is the hydrogen bond donor count of 3,4,5-Tribromobiphenyl?
The hydrogen bond donor count is 0.
What is the hydrogen bond acceptor count of 3,4,5-Tribromobiphenyl?
The hydrogen bond acceptor count is 0.