3-([3-(Trifluoromethyl)benzyl]oxy)benzaldehyde

• Catalog Number: ACMA00002548
• Category: Ethers
• Molecular Weight: 280.24
• Hazard Statements: H301
• RIDADR: NONH for all modes of transport
• Symbol: GHS06

Custom Q&A

What is the molecular formula of the compound with PubChem CID 3787854?

The molecular formula is C15H11F3O2.

When was the compound first created?

The compound was first created on September 11, 2005.

What is the molecular weight of the compound?

The molecular weight is 280.24 g/mol.

What is the IUPAC name of the compound?

The IUPAC name is 3-[[3-(trifluoromethyl)phenyl]methoxy]benzaldehyde.

What is the Canonical SMILES representation of the compound?

The Canonical SMILES representation is C1=CC(=CC(=C1)C(F)(F)F)COC2=CC=CC(=C2)C=O.

What is the InChIKey of the compound?

The InChIKey is OXBDHTPFAFXIEA-UHFFFAOYSA-N.

What is the XLogP3-AA value of the compound?

The XLogP3-AA value is 3.7.

How many hydrogen bond acceptors are in the compound?

There are 5 hydrogen bond acceptors in the compound.

What is the topological polar surface area of the compound?

The topological polar surface area is 26.3 Ų.

Is the compound canonicalized?

Yes, the compound is canonicalized according to PubChem.

When was the compound created in PubChem?

The compound was created on September 11, 2005.

How many hydrogen bond donor counts does the compound have?

The compound has 0 hydrogen bond donor counts.

Does the compound have any defined atom stereocenter counts?

No, the compound has 0 defined atom stereocenter counts.