What is the molecular formula of 3,3-oxetanedimethanamine dihydrochloride?
The molecular formula of 3,3-oxetanedimethanamine dihydrochloride is C5H14Cl2N2O.
What are the synonyms of 3,3-oxetanedimethanamine dihydrochloride?
The synonyms of 3,3-oxetanedimethanamine dihydrochloride include 111511-89-8, 3,3-bis-aminomethyl-oxetane dihydrochloride, [3-(aminomethyl)oxetan-3-yl]methanamine; dihydrochloride, and Oxetane-3,3-diyldimethanamine dihydrochloride.
What is the molecular weight of 3,3-oxetanedimethanamine dihydrochloride?
The molecular weight of 3,3-oxetanedimethanamine dihydrochloride is 189.08 g/mol.
What is the IUPAC name of 3,3-oxetanedimethanamine dihydrochloride?
The IUPAC name of 3,3-oxetanedimethanamine dihydrochloride is [3-(aminomethyl)oxetan-3-yl]methanamine; dihydrochloride.
What is the InChI of 3,3-oxetanedimethanamine dihydrochloride?
The InChI of 3,3-oxetanedimethanamine dihydrochloride is InChI=1S/C5H12N2O.2ClH/c6-1-5(2-7)3-8-4-5;;/h1-4,6-7H2;2*1H.
What is the InChIKey of 3,3-oxetanedimethanamine dihydrochloride?
The InChIKey of 3,3-oxetanedimethanamine dihydrochloride is POPWYXVILDNQQS-UHFFFAOYSA-N.
What is the canonical SMILES of 3,3-oxetanedimethanamine dihydrochloride?
The canonical SMILES of 3,3-oxetanedimethanamine dihydrochloride is C1C(CO1)(CN)CN.Cl.Cl.
What is the hydrogen bond donor count of 3,3-oxetanedimethanamine dihydrochloride?
The hydrogen bond donor count of 3,3-oxetanedimethanamine dihydrochloride is 4.
What is the hydrogen bond acceptor count of 3,3-oxetanedimethanamine dihydrochloride?
The hydrogen bond acceptor count of 3,3-oxetanedimethanamine dihydrochloride is 3.
How many covalently-bonded units are present in 3,3-oxetanedimethanamine dihydrochloride?
There are 3 covalently-bonded units present in 3,3-oxetanedimethanamine dihydrochloride.
※ Please kindly note that our products are for research use only.