What is the molecular formula of 3,3-Diethoxy-1-propyne?
The molecular formula of 3,3-Diethoxy-1-propyne is C7H12O2.
What is the molecular weight of 3,3-Diethoxy-1-propyne?
The molecular weight of 3,3-Diethoxy-1-propyne is 128.17 g/mol.
What is the IUPAC name of 3,3-Diethoxy-1-propyne?
The IUPAC name of 3,3-Diethoxy-1-propyne is 3,3-diethoxyprop-1-yne.
What is the InChI of 3,3-Diethoxy-1-propyne?
The InChI of 3,3-Diethoxy-1-propyne is InChI=1S/C7H12O2/c1-4-7(8-5-2)9-6-3/h1,7H,5-6H2,2-3H3.
What is the InChIKey of 3,3-Diethoxy-1-propyne?
The InChIKey of 3,3-Diethoxy-1-propyne is RGUXEWWHSQGVRZ-UHFFFAOYSA-N.
What is the CAS number of 3,3-Diethoxy-1-propyne?
The CAS number of 3,3-Diethoxy-1-propyne is 10160-87-9.
What is the EC number of 3,3-Diethoxy-1-propyne?
The EC number of 3,3-Diethoxy-1-propyne is 233-430-4.
What is the DSSTox Substance ID of 3,3-Diethoxy-1-propyne?
The DSSTox Substance ID of 3,3-Diethoxy-1-propyne is DTXSID60144050.
What is the XLogP3-AA value of 3,3-Diethoxy-1-propyne?
The XLogP3-AA value of 3,3-Diethoxy-1-propyne is 0.9.
Is 3,3-Diethoxy-1-propyne a canonicalized compound?
Yes, 3,3-Diethoxy-1-propyne is a canonicalized compound.