What is the molecular formula of 3-(2-Methylphenoxy)benzylamine hydrochloride?
The molecular formula of 3-(2-Methylphenoxy)benzylamine hydrochloride is C14H16ClNO.
What is the molecular weight of 3-(2-Methylphenoxy)benzylamine hydrochloride?
The molecular weight of 3-(2-Methylphenoxy)benzylamine hydrochloride is 249.73 g/mol.
What is the IUPAC name of 3-(2-Methylphenoxy)benzylamine hydrochloride?
The IUPAC name of 3-(2-Methylphenoxy)benzylamine hydrochloride is [3-(2-methylphenoxy)phenyl]methanamine;hydrochloride.
What is the InChI code of 3-(2-Methylphenoxy)benzylamine hydrochloride?
The InChI code of 3-(2-Methylphenoxy)benzylamine hydrochloride is InChI=1S/C14H15NO.ClH/c1-11-5-2-3-8-14(11)16-13-7-4-6-12(9-13)10-15;/h2-9H,10,15H2,1H3;1H.
What is the InChIKey of 3-(2-Methylphenoxy)benzylamine hydrochloride?
The InChIKey of 3-(2-Methylphenoxy)benzylamine hydrochloride is ICOJZRXRWNBHRK-UHFFFAOYSA-N.
What is the canonical SMILES of 3-(2-Methylphenoxy)benzylamine hydrochloride?
The canonical SMILES of 3-(2-Methylphenoxy)benzylamine hydrochloride is CC1=CC=CC=C1OC2=CC=CC(=C2)CN.Cl.
What is the CAS number of 3-(2-Methylphenoxy)benzylamine hydrochloride?
The CAS number of 3-(2-Methylphenoxy)benzylamine hydrochloride is 1172985-31-7.
What is the hydrogen bond donor count of 3-(2-Methylphenoxy)benzylamine hydrochloride?
The hydrogen bond donor count of 3-(2-Methylphenoxy)benzylamine hydrochloride is 2.
What is the hydrogen bond acceptor count of 3-(2-Methylphenoxy)benzylamine hydrochloride?
The hydrogen bond acceptor count of 3-(2-Methylphenoxy)benzylamine hydrochloride is 2.
※ Please kindly note that our products are for research use only.