What is the molecular formula of 3-(2-Aminoethyl)-1,3-oxazinan-2-one hydrochloride?
The molecular formula is C6H13ClN2O2.
What is the molecular weight of 3-(2-Aminoethyl)-1,3-oxazinan-2-one hydrochloride?
The molecular weight is 180.63 g/mol.
What is the IUPAC name of 3-(2-Aminoethyl)-1,3-oxazinan-2-one hydrochloride?
The IUPAC name is 3-(2-aminoethyl)-1,3-oxazinan-2-one;hydrochloride.
What is the InChI of 3-(2-Aminoethyl)-1,3-oxazinan-2-one hydrochloride?
The InChI is InChI=1S/C6H12N2O2.ClH/c7-2-4-8-3-1-5-10-6(8)9;/h1-5,7H2;1H.
What is the InChIKey of 3-(2-Aminoethyl)-1,3-oxazinan-2-one hydrochloride?
The InChIKey is HTYWXTQWTBFBLB-UHFFFAOYSA-N.
How many hydrogen bond donor counts are in 3-(2-Aminoethyl)-1,3-oxazinan-2-one hydrochloride?
There are 2 hydrogen bond donor counts.
How many hydrogen bond acceptor counts are in 3-(2-Aminoethyl)-1,3-oxazinan-2-one hydrochloride?
There are 3 hydrogen bond acceptor counts.
What is the exact mass of 3-(2-Aminoethyl)-1,3-oxazinan-2-one hydrochloride?
The exact mass is 180.0665554 g/mol.
How many rotatable bond counts are there in 3-(2-Aminoethyl)-1,3-oxazinan-2-one hydrochloride?
There are 2 rotatable bond counts.
Is 3-(2-Aminoethyl)-1,3-oxazinan-2-one hydrochloride a canonicalized compound?
Yes, the compound is canonicalized.