Answer: The IUPAC name of the compound is 3-(2,5-dioxoimidazolidin-4-yl)propanoic acid.
What is the molecular formula of the compound?
Answer: The molecular formula of the compound is C6H8N2O4.
What are some synonyms for the compound?
Answer: Some synonyms for the compound include hydantoin-5-propionic acid, 3-(2,5-dioxo-imidazolidin-4-yl)-propionic acid, and 2,5-dioxo-4-imidazolidinepropanoic acid.
What is the CAS number of the compound?
Answer: The CAS number of the compound is 5624-26-0.
What are the computed properties of the compound?
Answer: The computed properties of the compound include a molecular weight of 172.14 g/mol, an XLogP3 value of -1.2, a hydrogen bond donor count of 3, a hydrogen bond acceptor count of 4, a rotatable bond count of 3, an exact mass of 172.04840674 g/mol, a monoisotopic mass of 172.04840674 g/mol, a topological polar surface area of 95.5 Ų, and a heavy atom count of 12.
What is the InChI of the compound?
Answer: The InChI of the compound is "InChI=1S/C6H8N2O4/c9-4(10)2-1-3-5(11)8-6(12)7-3/h3H,1-2H2,(H,9,10)(H2,7,8,11,12)".
What is the InChIKey of the compound?
Answer: The InChIKey of the compound is "VWFWNXQAMGDPGG-UHFFFAOYSA-N".
What is the exact mass of the compound?
Answer: The exact mass of the compound is 172.04840674 g/mol.
What is the hydrogen bond donor count of the compound?
Answer: The hydrogen bond donor count of the compound is 3.
What is the hydrogen bond acceptor count of the compound?
Answer: The hydrogen bond acceptor count of the compound is 4.
※ Please kindly note that our products are for research use only.