What is the molecular formula of 21-Acetoxypregnenolone?
The molecular formula of 21-Acetoxypregnenolone is C23H34O4.
What is the molecular weight of 21-Acetoxypregnenolone?
The molecular weight of 21-Acetoxypregnenolone is 374.5 g/mol.
What is the IUPAC name of 21-Acetoxypregnenolone?
The IUPAC name of 21-Acetoxypregnenolone is [2-[(3S,8S,9S,10R,13S,14S,17S)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-oxoethyl] acetate.
What is the InChI of 21-Acetoxypregnenolone?
The InChI of 21-Acetoxypregnenolone is InChI=1S/C23H34O4/c1-14(24)27-13-21(26)20-7-6-18-17-5-4-15-12-16(25)8-10-22(15,2)19(17)9-11-23(18,20)3/h4,16-20,25H,5-13H2,1-3H3/t16-,17-,18-,19-,20+,22-,23-/m0/s1.
What is the InChIKey of 21-Acetoxypregnenolone?
The InChIKey of 21-Acetoxypregnenolone is MDJRZSNPHZEMJH-MTMZYOSNSA-N.
What is the canonical SMILES of 21-Acetoxypregnenolone?
The canonical SMILES of 21-Acetoxypregnenolone is CC(=O)OCC(=O)C1CCC2C1(CCC3C2CC=C4C3(CCC(C4)O)C).
What is the CAS number of 21-Acetoxypregnenolone?
The CAS number of 21-Acetoxypregnenolone is 566-78-9.
What is the ChEMBL ID of 21-Acetoxypregnenolone?
The ChEMBL ID of 21-Acetoxypregnenolone is CHEMBL1328310.
What is the UNII of 21-Acetoxypregnenolone?
The UNII of 21-Acetoxypregnenolone is DX3XOD2S6B.
What is the Wikipedia page for 21-Acetoxypregnenolone?
The Wikipedia page for 21-Acetoxypregnenolone is Prebediolone_acetate.