The synonyms are 1356087-58-5, (6-((tert-Butoxycarbonyl)amino)-5-methylpyridin-3-yl)boronic acid, 2-tert-butyloxycarbonylamino-3-methylpyridine-5-boronic acid, [5-methyl-6-[(2-methylpropan-2-yl)oxycarbonylamino]pyridin-3-yl]boronic acid, and (6-{[(tert-butoxy)carbonyl]amino}-5-methylpyridin-3-yl)boronic acid.
When was the compound created?
The compound was created on May 31, 2013.
When was the compound last modified?
The compound was last modified on December 2, 2023.
What is the IUPAC name of the compound?
The IUPAC name is [5-methyl-6-[(2-methylpropan-2-yl)oxycarbonylamino]pyridin-3-yl]boronic acid.
What is the InChI of the compound?
The InChI is InChI=1S/C11H17BN2O4/c1-7-5-8(12(16)17)6-13-9(7)14-10(15)18-11(2,3)4/h5-6,16-17H,1-4H3,(H,13,14,15).
What is the InChIKey of the compound?
The InChIKey is YEHXEJUMAMZEKC-UHFFFAOYSA-N.
What is the canonical SMILES of the compound?
The canonical SMILES is B(C1=CC(=C(N=C1)NC(=O)OC(C)(C)C)C)(O)O.
What is the molecular weight of the compound?
The molecular weight is 252.08 g/mol.
Is the compound canonicalized?
Yes, the compound is canonicalized.
※ Please kindly note that our products are for research use only.