What is the molecular formula of 2-tert-Butyl-imidazo[1,2-a]pyridin-6-ylamine?
The molecular formula is C11H15N3.
What is the molecular weight of 2-tert-Butyl-imidazo[1,2-a]pyridin-6-ylamine?
The molecular weight is 189.26 g/mol.
When was 2-tert-Butyl-imidazo[1,2-a]pyridin-6-ylamine created?
It was created on October 2, 2007.
When was 2-tert-Butyl-imidazo[1,2-a]pyridin-6-ylamine last modified?
It was last modified on November 25, 2023.
What is the IUPAC name of 2-tert-Butyl-imidazo[1,2-a]pyridin-6-ylamine?
The IUPAC name is 2-tert-butylimidazo[1,2-a]pyridin-6-amine.
What is the InChI of 2-tert-Butyl-imidazo[1,2-a]pyridin-6-ylamine?
The InChI is InChI=1S/C11H15N3/c1-11(2,3)9-7-14-6-8(12)4-5-10(14)13-9/h4-7H,12H2,1-3H3.
What is the InChIKey of 2-tert-Butyl-imidazo[1,2-a]pyridin-6-ylamine?
The InChIKey is XAGCUBLRYLVAPL-UHFFFAOYSA-N.
What is the canonical SMILES of 2-tert-Butyl-imidazo[1,2-a]pyridin-6-ylamine?
The canonical SMILES is CC(C)(C)C1=CN2C=C(C=CC2=N1)N.
What is the CAS number of 2-tert-Butyl-imidazo[1,2-a]pyridin-6-ylamine?
The CAS number is 904814-15-9.
What is the XLogP3-AA value of 2-tert-Butyl-imidazo[1,2-a]pyridin-6-ylamine?
The XLogP3-AA value is 2.8.