What is the CID of 2-sec-Butoxybenzaldehyde?
The CID of 2-sec-Butoxybenzaldehyde is 21211301.
What is the molecular formula of 2-sec-Butoxybenzaldehyde?
The molecular formula of 2-sec-Butoxybenzaldehyde is C11H14O2.
What are the synonyms of 2-sec-Butoxybenzaldehyde?
The synonyms of 2-sec-Butoxybenzaldehyde are 2-(Sec-butoxy)benzaldehyde, 2-butan-2-yloxybenzaldehyde, and Benzaldehyde, 2-(1-methylpropoxy)-.
What is the molecular weight of 2-sec-Butoxybenzaldehyde?
The molecular weight of 2-sec-Butoxybenzaldehyde is 178.23 g/mol.
What is the IUPAC name of 2-sec-Butoxybenzaldehyde?
The IUPAC name of 2-sec-Butoxybenzaldehyde is 2-butan-2-yloxybenzaldehyde.
What is the InChI of 2-sec-Butoxybenzaldehyde?
The InChI of 2-sec-Butoxybenzaldehyde is InChI=1S/C11H14O2/c1-3-9(2)13-11-7-5-4-6-10(11)8-12/h4-9H,3H2,1-2H3.
What is the InChIKey of 2-sec-Butoxybenzaldehyde?
The InChIKey of 2-sec-Butoxybenzaldehyde is NHIGQSREBZKSAJ-UHFFFAOYSA-N.
What is the Canonical SMILES of 2-sec-Butoxybenzaldehyde?
The Canonical SMILES of 2-sec-Butoxybenzaldehyde is CCC(C)OC1=CC=CC=C1C=O.
What is the CAS number of 2-sec-Butoxybenzaldehyde?
The CAS number of 2-sec-Butoxybenzaldehyde is 22921-59-1.
Is 2-sec-Butoxybenzaldehyde a canonicalized compound?
Yes, 2-sec-Butoxybenzaldehyde is a canonicalized compound.