What is the PubChem CID for 2-Pyridineboronic acid?
The PubChem CID for 2-Pyridineboronic acid is 2762745.
What is the molecular formula of 2-Pyridineboronic acid?
The molecular formula of 2-Pyridineboronic acid is C5H6BNO2.
What is the molecular weight of 2-Pyridineboronic acid?
The molecular weight of 2-Pyridineboronic acid is 122.92 g/mol.
What is the IUPAC name of 2-Pyridineboronic acid?
The IUPAC name of 2-Pyridineboronic acid is pyridin-2-ylboronic acid.
What is the InChI of 2-Pyridineboronic acid?
The InChI of 2-Pyridineboronic acid is InChI=1S/C5H6BNO2/c8-6(9)5-3-1-2-4-7-5/h1-4,8-9H.
What is the InChIKey of 2-Pyridineboronic acid?
The InChIKey of 2-Pyridineboronic acid is UMLDUMMLRZFROX-UHFFFAOYSA-N.
What is the CAS number of 2-Pyridineboronic acid?
The CAS number of 2-Pyridineboronic acid is 197958-29-5.
What is the EC number of 2-Pyridineboronic acid?
The EC number of 2-Pyridineboronic acid is 803-283-6.
What is the molecular weight of 2-Pyridineboronic acid according to PubChem?
The molecular weight of 2-Pyridineboronic acid according to PubChem is 122.92 g/mol.
Is 2-Pyridineboronic acid a canonicalized compound?
Yes, 2-Pyridineboronic acid is a canonicalized compound according to PubChem.