What is the molecular formula of 2-Propylsuccinic acid?
The molecular formula of 2-Propylsuccinic acid is C7H12O4.
What are the synonyms for 2-Propylsuccinic acid?
The synonyms for 2-Propylsuccinic acid are 2-propylbutanedioic acid, 618-57-5, 2-PROPYL SUCCINIC ACID, and 2-PSA.
What is the molecular weight of 2-Propylsuccinic acid?
The molecular weight of 2-Propylsuccinic acid is 160.17 g/mol.
When was 2-Propylsuccinic acid created?
2-Propylsuccinic acid was created on August 8, 2005.
Is 2-Propylsuccinic acid a dicarboxylic acid?
Yes, 2-Propylsuccinic acid is a dicarboxylic acid.
What is the IUPAC name of 2-Propylsuccinic acid?
The IUPAC name of 2-Propylsuccinic acid is 2-propylbutanedioic acid.
What is the InChI of 2-Propylsuccinic acid?
The InChI of 2-Propylsuccinic acid is InChI=1S/C7H12O4/c1-2-3-5(7(10)11)4-6(8)9/h5H,2-4H2,1H3,(H,8,9)(H,10,11).
What is the InChIKey of 2-Propylsuccinic acid?
The InChIKey of 2-Propylsuccinic acid is QLTZBYGZXPKHLF-UHFFFAOYSA-N.
How many hydrogen bond donor counts does 2-Propylsuccinic acid have?
2-Propylsuccinic acid has two hydrogen bond donor counts.
What is the topological polar surface area of 2-Propylsuccinic acid?
The topological polar surface area of 2-Propylsuccinic acid is 74.6Ų.