What is the molecular formula of 2-Phenylpentane?
The molecular formula of 2-Phenylpentane is C11H16.
What are the synonyms of 2-Phenylpentane?
The synonyms of 2-Phenylpentane are sec-Pentylbenzene and pentan-2-ylbenzene.
What is the molecular weight of 2-Phenylpentane?
The molecular weight of 2-Phenylpentane is 148.24 g/mol.
When was 2-Phenylpentane created?
2-Phenylpentane was created on March 27, 2005.
When was 2-Phenylpentane last modified?
2-Phenylpentane was last modified on October 21, 2023.
What is the IUPAC name of 2-Phenylpentane?
The IUPAC name of 2-Phenylpentane is pentan-2-ylbenzene.
What is the InChI of 2-Phenylpentane?
The InChI of 2-Phenylpentane is InChI=1S/C11H16/c1-3-7-10(2)11-8-5-4-6-9-11/h4-6,8-10H,3,7H2,1-2H3.
What is the InChIKey of 2-Phenylpentane?
The InChIKey of 2-Phenylpentane is LTHAIAJHDPJXLG-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Phenylpentane?
The canonical SMILES of 2-Phenylpentane is CCCC(C)C1=CC=CC=C1.
What is the CAS number of 2-Phenylpentane?
The CAS number of 2-Phenylpentane is 2719-52-0.