What is the PubChem CID number for 2-Phenylethenesulfonyl fluoride?
The PubChem CID number for 2-Phenylethenesulfonyl fluoride is 5357730.
What is the molecular formula of 2-Phenylethenesulfonyl fluoride?
The molecular formula of 2-Phenylethenesulfonyl fluoride is C8H7FO2S.
What are some synonyms for 2-Phenylethenesulfonyl fluoride?
Some synonyms for 2-Phenylethenesulfonyl fluoride are Ethenesulfonyl fluoride, 2-phenyl-, (E)-2-phenylethene-1-sulfonyl fluoride, and 2-phenylethene-1-sulfonyl fluoride.
What is the molecular weight of 2-Phenylethenesulfonyl fluoride?
The molecular weight of 2-Phenylethenesulfonyl fluoride is 186.21 g/mol.
What is the IUPAC name of 2-Phenylethenesulfonyl fluoride?
The IUPAC name of 2-Phenylethenesulfonyl fluoride is (E)-2-phenylethenesulfonyl fluoride.
What is the InChI of 2-Phenylethenesulfonyl fluoride?
The InChI of 2-Phenylethenesulfonyl fluoride is InChI=1S/C8H7FO2S/c9-12(10,11)7-6-8-4-2-1-3-5-8/h1-7H/b7-6+.
What is the InChIKey of 2-Phenylethenesulfonyl fluoride?
The InChIKey of 2-Phenylethenesulfonyl fluoride is VDCNEIUADPFQPG-VOTSOKGWSA-N.
What is the Canonical SMILES of 2-Phenylethenesulfonyl fluoride?
The Canonical SMILES of 2-Phenylethenesulfonyl fluoride is C1=CC=C(C=C1)C=CS(=O)(=O)F.
What is the CAS number of 2-Phenylethenesulfonyl fluoride?
The CAS number of 2-Phenylethenesulfonyl fluoride is 405-18-5.
Does 2-Phenylethenesulfonyl fluoride have any hydrogen bond donor count?
No, 2-Phenylethenesulfonyl fluoride does not have any hydrogen bond donor count.
※ Please kindly note that our products are for research use only.