What is the molecular formula of 2-Phenylbutan-1-amine?
The molecular formula of 2-Phenylbutan-1-amine is C10H15N.
What is the molecular weight of 2-Phenylbutan-1-amine?
The molecular weight of 2-Phenylbutan-1-amine is 149.23 g/mol.
What is the IUPAC name of 2-Phenylbutan-1-amine?
The IUPAC name of 2-Phenylbutan-1-amine is 2-phenylbutan-1-amine.
What is the InChI of 2-Phenylbutan-1-amine?
The InChI of 2-Phenylbutan-1-amine is InChI=1S/C10H15N/c1-2-9(8-11)10-6-4-3-5-7-10/h3-7,9H,2,8,11H2,1H3.
What is the InChIKey of 2-Phenylbutan-1-amine?
The InChIKey of 2-Phenylbutan-1-amine is PLWALTDUYKDGRF-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Phenylbutan-1-amine?
The canonical SMILES of 2-Phenylbutan-1-amine is CCC(CN)C1=CC=CC=C1.
What is the XLogP3-AA value of 2-Phenylbutan-1-amine?
The XLogP3-AA value of 2-Phenylbutan-1-amine is 1.9.
How many hydrogen bond donor counts does 2-Phenylbutan-1-amine have?
2-Phenylbutan-1-amine has 1 hydrogen bond donor count.
How many hydrogen bond acceptor counts does 2-Phenylbutan-1-amine have?
2-Phenylbutan-1-amine has 1 hydrogen bond acceptor count.
How many rotatable bond counts does 2-Phenylbutan-1-amine have?
2-Phenylbutan-1-amine has 3 rotatable bond counts.