What is the molecular formula of 2-Phenylbenzylamine?
The molecular formula of 2-Phenylbenzylamine is C13H13N.
What is the molecular weight of 2-Phenylbenzylamine?
The molecular weight of 2-Phenylbenzylamine is 183.25 g/mol.
What is the IUPAC name of 2-Phenylbenzylamine?
The IUPAC name of 2-Phenylbenzylamine is (2-phenylphenyl)methanamine.
What is the InChI code of 2-Phenylbenzylamine?
The InChI code of 2-Phenylbenzylamine is InChI=1S/C13H13N/c14-10-12-8-4-5-9-13(12)11-6-2-1-3-7-11/h1-9H,10,14H2.
What is the InChIKey of 2-Phenylbenzylamine?
The InChIKey of 2-Phenylbenzylamine is YHXKXVFQHWJYOD-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Phenylbenzylamine?
The canonical SMILES of 2-Phenylbenzylamine is C1=CC=C(C=C1)C2=CC=CC=C2CN.
What is the CAS number of 2-Phenylbenzylamine?
The CAS number of 2-Phenylbenzylamine is 1924-77-2.
What is the XLogP3-AA value of 2-Phenylbenzylamine?
The XLogP3-AA value of 2-Phenylbenzylamine is 2.4.
What is the hydrogen bond donor count of 2-Phenylbenzylamine?
The hydrogen bond donor count of 2-Phenylbenzylamine is 1.
Is 2-Phenylbenzylamine a canonicalized compound?
Yes, 2-Phenylbenzylamine is a canonicalized compound.