What is the molecular formula of 2-Phenyl-1,3,2-dioxaborolane?
The molecular formula of 2-Phenyl-1,3,2-dioxaborolane is C8H9BO2.
What are some synonyms for 2-Phenyl-1,3,2-dioxaborolane?
Some synonyms for 2-Phenyl-1,3,2-dioxaborolane include "1,3,2-Dioxaborolane, 2-phenyl-", "Benzeneboronic acid, cyclic ethylene ester", and "starbld0012963".
What is the molecular weight of 2-Phenyl-1,3,2-dioxaborolane?
The molecular weight of 2-Phenyl-1,3,2-dioxaborolane is 147.97 g/mol.
When was 2-Phenyl-1,3,2-dioxaborolane created?
2-Phenyl-1,3,2-dioxaborolane was created on March 27, 2005.
What is the IUPAC name of 2-Phenyl-1,3,2-dioxaborolane?
The IUPAC name of 2-Phenyl-1,3,2-dioxaborolane is "2-phenyl-1,3,2-dioxaborolane".
What is the InChI of 2-Phenyl-1,3,2-dioxaborolane?
The InChI of 2-Phenyl-1,3,2-dioxaborolane is "InChI=1S/C8H9BO2/c1-2-4-8(5-3-1)9-10-6-7-11-9/h1-5H,6-7H2".
What is the InChIKey of 2-Phenyl-1,3,2-dioxaborolane?
The InChIKey of 2-Phenyl-1,3,2-dioxaborolane is "HVEMPDZEMICSMG-UHFFFAOYSA-N".
What is the canonical SMILES of 2-Phenyl-1,3,2-dioxaborolane?
The canonical SMILES of 2-Phenyl-1,3,2-dioxaborolane is "B1(OCCO1)C2=CC=CC=C2".
What is the CAS number of 2-Phenyl-1,3,2-dioxaborolane?
The CAS number of 2-Phenyl-1,3,2-dioxaborolane is 4406-72-8.
What is the hydrogen bond acceptor count of 2-Phenyl-1,3,2-dioxaborolane?
The hydrogen bond acceptor count of 2-Phenyl-1,3,2-dioxaborolane is 2.
※ Please kindly note that our products are for research use only.