What is the molecular formula of 2-(Phenoxymethyl)aniline?
The molecular formula of 2-(Phenoxymethyl)aniline is C13H13NO.
What is the molecular weight of 2-(Phenoxymethyl)aniline?
The molecular weight of 2-(Phenoxymethyl)aniline is 199.25 g/mol.
What is the IUPAC name of 2-(Phenoxymethyl)aniline?
The IUPAC name of 2-(Phenoxymethyl)aniline is 2-(phenoxymethyl)aniline.
What is the InChI of 2-(Phenoxymethyl)aniline?
The InChI of 2-(Phenoxymethyl)aniline is InChI=1S/C13H13NO/c14-13-9-5-4-6-11(13)10-15-12-7-2-1-3-8-12/h1-9H,10,14H2.
What is the InChIKey of 2-(Phenoxymethyl)aniline?
The InChIKey of 2-(Phenoxymethyl)aniline is MWUVUHYPGPVVOB-UHFFFAOYSA-N.
What is the canonical SMILES of 2-(Phenoxymethyl)aniline?
The canonical SMILES of 2-(Phenoxymethyl)aniline is C1=CC=C(C=C1)OCC2=CC=CC=C2N.
What is the CAS number of 2-(Phenoxymethyl)aniline?
The CAS number of 2-(Phenoxymethyl)aniline is 78584-41-5.
What is the EC number of 2-(Phenoxymethyl)aniline?
The EC number of 2-(Phenoxymethyl)aniline is 889-980-6.
What is the hydrogen bond donor count of 2-(Phenoxymethyl)aniline?
The hydrogen bond donor count of 2-(Phenoxymethyl)aniline is 1.
What is the hydrogen bond acceptor count of 2-(Phenoxymethyl)aniline?
The hydrogen bond acceptor count of 2-(Phenoxymethyl)aniline is 2.