What is the molecular formula of 2-Phenoxybenzhydrazide?
The molecular formula of 2-Phenoxybenzhydrazide is C13H12N2O2.
What is the molecular weight of 2-Phenoxybenzhydrazide?
The molecular weight of 2-Phenoxybenzhydrazide is 228.25 g/mol.
What is the IUPAC name of 2-Phenoxybenzhydrazide?
The IUPAC name of 2-Phenoxybenzhydrazide is 2-phenoxybenzohydrazide.
What is the InChI of 2-Phenoxybenzhydrazide?
The InChI of 2-Phenoxybenzhydrazide is InChI=1S/C13H12N2O2/c14-15-13(16)11-8-4-5-9-12(11)17-10-6-2-1-3-7-10/h1-9H,14H2,(H,15,16).
What is the InChIKey of 2-Phenoxybenzhydrazide?
The InChIKey of 2-Phenoxybenzhydrazide is PIMAJOVNMMNVCZ-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Phenoxybenzhydrazide?
The canonical SMILES of 2-Phenoxybenzhydrazide is C1=CC=C(C=C1)OC2=CC=CC=C2C(=O)NN.
What is the CAS number of 2-Phenoxybenzhydrazide?
The CAS number of 2-Phenoxybenzhydrazide is 43038-37-5.
How many hydrogen bond donor counts does 2-Phenoxybenzhydrazide have?
2-Phenoxybenzhydrazide has 2 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does 2-Phenoxybenzhydrazide have?
2-Phenoxybenzhydrazide has 3 hydrogen bond acceptor counts.
What is the topological polar surface area of 2-Phenoxybenzhydrazide?
The topological polar surface area of 2-Phenoxybenzhydrazide is 64.4Ų.