What is the molecular formula of 2-Phenoxybenzaldehyde?
The molecular formula of 2-Phenoxybenzaldehyde is C13H10O2.
What is the molecular weight of 2-Phenoxybenzaldehyde?
The molecular weight of 2-Phenoxybenzaldehyde is 198.22 g/mol.
What is the IUPAC name of 2-Phenoxybenzaldehyde?
The IUPAC name of 2-Phenoxybenzaldehyde is 2-phenoxybenzaldehyde.
What is the InChI of 2-Phenoxybenzaldehyde?
The InChI of 2-Phenoxybenzaldehyde is InChI=1S/C13H10O2/c14-10-11-6-4-5-9-13(11)15-12-7-2-1-3-8-12/h1-10H.
What is the InChIKey of 2-Phenoxybenzaldehyde?
The InChIKey of 2-Phenoxybenzaldehyde is IMPIIVKYTNMBCD-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Phenoxybenzaldehyde?
The canonical SMILES of 2-Phenoxybenzaldehyde is C1=CC=C(C=C1)OC2=CC=CC=C2C=O.
What is the CAS number of 2-Phenoxybenzaldehyde?
The CAS number of 2-Phenoxybenzaldehyde is 19434-34-5.
What is the XLogP3 value of 2-Phenoxybenzaldehyde?
The XLogP3 value of 2-Phenoxybenzaldehyde is 3.3.
How many hydrogen bond acceptor count does 2-Phenoxybenzaldehyde have?
2-Phenoxybenzaldehyde has 2 hydrogen bond acceptor count.
How many rotatable bond count does 2-Phenoxybenzaldehyde have?
2-Phenoxybenzaldehyde has 3 rotatable bond count.