What is the molecular formula of 2-Naphthyloxyethanamide?
The molecular formula of 2-Naphthyloxyethanamide is C12H11NO2.
What is the molecular weight of 2-Naphthyloxyethanamide?
The molecular weight of 2-Naphthyloxyethanamide is 201.22 g/mol.
What is the IUPAC name of 2-Naphthyloxyethanamide?
The IUPAC name of 2-Naphthyloxyethanamide is 2-naphthalen-1-yloxyacetamide.
What is the InChI of 2-Naphthyloxyethanamide?
The InChI of 2-Naphthyloxyethanamide is InChI=1S/C12H11NO2/c13-12(14)8-15-11-7-3-5-9-4-1-2-6-10(9)11/h1-7H,8H2,(H2,13,14).
What is the InChIKey of 2-Naphthyloxyethanamide?
The InChIKey of 2-Naphthyloxyethanamide is DEZGTCIAWFYNLJ-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Naphthyloxyethanamide?
The canonical SMILES of 2-Naphthyloxyethanamide is C1=CC=C2C(=C1)C=CC=C2OCC(=O)N.
What is the XLogP3 value of 2-Naphthyloxyethanamide?
The XLogP3 value of 2-Naphthyloxyethanamide is 2.1.
How many hydrogen bond donor counts are there in 2-Naphthyloxyethanamide?
There is 1 hydrogen bond donor count in 2-Naphthyloxyethanamide.
How many hydrogen bond acceptor counts are there in 2-Naphthyloxyethanamide?
There are 2 hydrogen bond acceptor counts in 2-Naphthyloxyethanamide.
How many rotatable bond counts are there in 2-Naphthyloxyethanamide?
There are 3 rotatable bond counts in 2-Naphthyloxyethanamide.