What is the molecular formula of 2-N-Propoxybenzoic acid?
The molecular formula of 2-N-Propoxybenzoic acid is C10H12O3.
What is the molecular weight of 2-N-Propoxybenzoic acid?
The molecular weight of 2-N-Propoxybenzoic acid is 180.20 g/mol.
What is the IUPAC name of 2-N-Propoxybenzoic acid?
The IUPAC name of 2-N-Propoxybenzoic acid is 2-propoxybenzoic acid.
What is the InChI of 2-N-Propoxybenzoic acid?
The InChI of 2-N-Propoxybenzoic acid is InChI=1S/C10H12O3/c1-2-7-13-9-6-4-3-5-8(9)10(11)12/h3-6H,2,7H2,1H3,(H,11,12).
What is the InChIKey of 2-N-Propoxybenzoic acid?
The InChIKey of 2-N-Propoxybenzoic acid is OXOWWPXTTOCKKU-UHFFFAOYSA-N.
What is the canonical SMILES of 2-N-Propoxybenzoic acid?
The canonical SMILES of 2-N-Propoxybenzoic acid is CCCOC1=CC=CC=C1C(=O)O.
What is the CAS number of 2-N-Propoxybenzoic acid?
The CAS number of 2-N-Propoxybenzoic acid is 2100-31-4.
What is the European Community (EC) number of 2-N-Propoxybenzoic acid?
The European Community (EC) number of 2-N-Propoxybenzoic acid is 606-685-8.
What is the DSSTox Substance ID of 2-N-Propoxybenzoic acid?
The DSSTox Substance ID of 2-N-Propoxybenzoic acid is DTXSID70337153.
What is the XLogP3 value of 2-N-Propoxybenzoic acid?
The XLogP3 value of 2-N-Propoxybenzoic acid is 2.5.