What is the molecular formula of 2-Methyl-5-nitroaniline?
The molecular formula of 2-Methyl-5-nitroaniline is C7H8N2O2.
What is the molecular weight of 2-Methyl-5-nitroaniline?
The molecular weight of 2-Methyl-5-nitroaniline is 152.15 g/mol.
What is the IUPAC name of 2-Methyl-5-nitroaniline?
The IUPAC name of 2-Methyl-5-nitroaniline is 2-methyl-5-nitroaniline.
What is the InChI key of 2-Methyl-5-nitroaniline?
The InChI key of 2-Methyl-5-nitroaniline is DSBIJCMXAIKKKI-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Methyl-5-nitroaniline?
The canonical SMILES of 2-Methyl-5-nitroaniline is CC1=C(C=C(C=C1)[N+](=O)[O-])N.
What is the CAS number of 2-Methyl-5-nitroaniline?
The CAS number of 2-Methyl-5-nitroaniline is 99-55-8.
What is the UNII of 2-Methyl-5-nitroaniline?
The UNII of 2-Methyl-5-nitroaniline is 433MYH2DWM.
What is the UN number of 2-Methyl-5-nitroaniline?
The UN number of 2-Methyl-5-nitroaniline is 2660.
How many hydrogen bond donor groups does 2-Methyl-5-nitroaniline have?
2-Methyl-5-nitroaniline has 1 hydrogen bond donor group.
How many hydrogen bond acceptor groups does 2-Methyl-5-nitroaniline have?
2-Methyl-5-nitroaniline has 3 hydrogen bond acceptor groups.
When was 2-Methyl-5-nitroaniline created and last modified?
It was created on March 26, 2005, and last modified on December 23, 2023.
What is the color of 2-Methyl-5-nitroaniline?
It is a bright yellow powder.
Are there any synonyms for 2-Methyl-5-nitroaniline?
Yes, some synonyms include 2-Amino-4-nitrotoluene and 5-NITRO-O-TOLUIDINE.
What is the InChIKey of 2-Methyl-5-nitroaniline?
The InChIKey is DSBIJCMXAIKKKI-UHFFFAOYSA-N.
How many hydrogen bond donor counts does 2-Methyl-5-nitroaniline have?
It has 1 hydrogen bond donor count.
How many hydrogen bond acceptor counts does 2-Methyl-5-nitroaniline have?
It has 3 hydrogen bond acceptor counts.
What is the heavy atom count of 2-Methyl-5-nitroaniline?
The heavy atom count is 11.