What is the molecular formula of 2-Methyl-4,5,6,7-tetrahydro-1-benzofuran-3-carboxylic acid?
The molecular formula is C10H12O3.
What are the synonyms of 2-Methyl-4,5,6,7-tetrahydro-1-benzofuran-3-carboxylic acid?
The synonyms are 65384-02-3, 2-Methyl-4,5,6,7-tetrahydrobenzofuran-3-carboxylic acid, 2-Methyl-4,5,6,7-tetrahydro-benzofuran-3-carboxylic acid, and 2-methyl-4,5,6,7-tetrahydro-1-benzofuran-3-carboxylic acid.
What is the molecular weight of 2-Methyl-4,5,6,7-tetrahydro-1-benzofuran-3-carboxylic acid?
The molecular weight is 180.20 g/mol.
What is the IUPAC name of 2-Methyl-4,5,6,7-tetrahydro-1-benzofuran-3-carboxylic acid?
The IUPAC name is 2-methyl-4,5,6,7-tetrahydro-1-benzofuran-3-carboxylic acid.
What is the InChI of 2-Methyl-4,5,6,7-tetrahydro-1-benzofuran-3-carboxylic acid?
The InChI is InChI=1S/C10H12O3/c1-6-9(10(11)12)7-4-2-3-5-8(7)13-6/h2-5H2,1H3,(H,11,12).
What is the InChIKey of 2-Methyl-4,5,6,7-tetrahydro-1-benzofuran-3-carboxylic acid?
The InChIKey is BBXHUEFHBLFIMD-UHFFFAOYSA-N.
What is the Canonical SMILES of 2-Methyl-4,5,6,7-tetrahydro-1-benzofuran-3-carboxylic acid?
The Canonical SMILES is CC1=C(C2=C(O1)CCCC2)C(=O)O.
What is the CAS number of 2-Methyl-4,5,6,7-tetrahydro-1-benzofuran-3-carboxylic acid?
The CAS number is 66091-48-3.
What is the XLogP3-AA value of 2-Methyl-4,5,6,7-tetrahydro-1-benzofuran-3-carboxylic acid?
The XLogP3-AA value is 2.1.
Is 2-Methyl-4,5,6,7-tetrahydro-1-benzofuran-3-carboxylic acid a canonicalized compound?
Yes, it is a canonicalized compound.
※ Please kindly note that our products are for research use only.