What is the molecular formula of 2-Methyl-2-heptene?
The molecular formula of 2-Methyl-2-heptene is C8H16.
What is the molecular weight of 2-Methyl-2-heptene?
The molecular weight of 2-Methyl-2-heptene is 112.21 g/mol.
What is the IUPAC name of 2-Methyl-2-heptene?
The IUPAC name of 2-Methyl-2-heptene is 2-methylhept-2-ene.
What is the InChI of 2-Methyl-2-heptene?
The InChI of 2-Methyl-2-heptene is InChI=1S/C8H16/c1-4-5-6-7-8(2)3/h7H,4-6H2,1-3H3.
What is the InChIKey of 2-Methyl-2-heptene?
The InChIKey of 2-Methyl-2-heptene is WEPNJTDVIIKRIK-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Methyl-2-heptene?
The canonical SMILES of 2-Methyl-2-heptene is CCCCC=C(C)C.
What is the CAS number of 2-Methyl-2-heptene?
The CAS number of 2-Methyl-2-heptene is 627-97-4.
What is the European Community (EC) number of 2-Methyl-2-heptene?
The European Community (EC) number of 2-Methyl-2-heptene is 211-022-7.
What is the DSSTox Substance ID of 2-Methyl-2-heptene?
The DSSTox Substance ID of 2-Methyl-2-heptene is DTXSID40211774.
Is 2-Methyl-2-heptene a canonicalized compound?
Yes, 2-Methyl-2-heptene is a canonicalized compound.