What is the molecular formula of 2-Methyl-1-nonene?
The molecular formula of 2-Methyl-1-nonene is C10H20.
What is the molecular weight of 2-Methyl-1-nonene?
The molecular weight of 2-Methyl-1-nonene is 140.27 g/mol.
What is the IUPAC name of 2-Methyl-1-nonene?
The IUPAC name of 2-Methyl-1-nonene is 2-methylnon-1-ene.
What is the InChI of 2-Methyl-1-nonene?
The InChI of 2-Methyl-1-nonene is InChI=1S/C10H20/c1-4-5-6-7-8-9-10(2)3/h2,4-9H2,1,3H3.
What is the InChIKey of 2-Methyl-1-nonene?
The InChIKey of 2-Methyl-1-nonene is YLZQHQUVNZVGOK-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Methyl-1-nonene?
The canonical SMILES of 2-Methyl-1-nonene is CCCCCCCC(=C)C.
What is the CAS number of 2-Methyl-1-nonene?
The CAS number of 2-Methyl-1-nonene is 2980-71-4.
What is the XLogP3-AA value of 2-Methyl-1-nonene?
The XLogP3-AA value of 2-Methyl-1-nonene is 5.2.
How many rotatable bonds does 2-Methyl-1-nonene have?
2-Methyl-1-nonene has 6 rotatable bonds.
Is 2-Methyl-1-nonene a canonicalized compound?
Yes, 2-Methyl-1-nonene is a canonicalized compound.