What is the molecular formula of 2-Methyl-1-hexene?
The molecular formula of 2-Methyl-1-hexene is C7H14.
What is the molecular weight of 2-Methyl-1-hexene?
The molecular weight of 2-Methyl-1-hexene is 98.19 g/mol.
What is the IUPAC name of 2-Methyl-1-hexene?
The IUPAC name of 2-Methyl-1-hexene is 2-methylhex-1-ene.
What is the InChI of 2-Methyl-1-hexene?
The InChI of 2-Methyl-1-hexene is InChI=1S/C7H14/c1-4-5-6-7(2)3/h2,4-6H2,1,3H3.
What is the InChIKey of 2-Methyl-1-hexene?
The InChIKey of 2-Methyl-1-hexene is IRUDSQHLKGNCGF-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Methyl-1-hexene?
The canonical SMILES of 2-Methyl-1-hexene is CCCCC(=C)C.
What is the CAS number of 2-Methyl-1-hexene?
The CAS number of 2-Methyl-1-hexene is 6094-02-6.
What is the EC number of 2-Methyl-1-hexene?
The EC number of 2-Methyl-1-hexene is 228-041-1.
What is the UNII of 2-Methyl-1-hexene?
The UNII of 2-Methyl-1-hexene is V54TLV711M.
What is the XLogP3-AA value of 2-Methyl-1-hexene?
The XLogP3-AA value of 2-Methyl-1-hexene is 3.6.