2-Methoxyphenylthioethanol

• Catalog Number: ACMA00002846
• Category: Ethers
• Molecular Weight: 184.26
• Molecular Formula: C₉H₁₂O₂S
• Hazard Statements: H315-H319-H335
• RIDADR: NONH for all modes of transport
• Symbol: GHS07

Custom Q&A

What is the molecular formula of 2-Methoxyphenylthioethanol?

The molecular formula is C9H12O2S.

What is the molecular weight of 2-Methoxyphenylthioethanol?

The molecular weight is 184.26 g/mol.

What is the IUPAC name of 2-Methoxyphenylthioethanol?

The IUPAC name is 2-(2-methoxyphenyl)sulfanylethanol.

What is the InChI code of 2-Methoxyphenylthioethanol?

The InChI code is InChI=1S/C9H12O2S/c1-11-8-4-2-3-5-9(8)12-7-6-10/h2-5,10H,6-7H2,1H3.

What is the InChIKey of 2-Methoxyphenylthioethanol?

The InChIKey is RCFKBAONIIUPAU-UHFFFAOYSA-N.

What is the canonical SMILES of 2-Methoxyphenylthioethanol?

The canonical SMILES is COC1=CC=CC=C1SCCO.

What is the CAS number of 2-Methoxyphenylthioethanol?

The CAS number is 13290-20-5.

What is the XLogP3-AA value of 2-Methoxyphenylthioethanol?

The XLogP3-AA value is 1.7.

How many hydrogen bond donor counts does 2-Methoxyphenylthioethanol have?

It has one hydrogen bond donor count.

How many rotatable bond counts does 2-Methoxyphenylthioethanol have?

It has four rotatable bond counts.