What is the PubChem CID for 2-Isopropenylnaphthalene?
The PubChem CID for 2-Isopropenylnaphthalene is 77301.
What is the molecular formula of 2-Isopropenylnaphthalene?
The molecular formula of 2-Isopropenylnaphthalene is C13H12.
What is the molecular weight of 2-Isopropenylnaphthalene?
The molecular weight of 2-Isopropenylnaphthalene is 168.23 g/mol.
What is the IUPAC name of 2-Isopropenylnaphthalene?
The IUPAC name of 2-Isopropenylnaphthalene is 2-prop-1-en-2-ylnaphthalene.
What is the InChI of 2-Isopropenylnaphthalene?
The InChI of 2-Isopropenylnaphthalene is InChI=1S/C13H12/c1-10(2)12-8-7-11-5-3-4-6-13(11)9-12/h3-9H,1H2,2H3.
What is the InChIKey of 2-Isopropenylnaphthalene?
The InChIKey of 2-Isopropenylnaphthalene is ANCUXNXTHQXICN-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Isopropenylnaphthalene?
The canonical SMILES of 2-Isopropenylnaphthalene is CC(=C)C1=CC2=CC=CC=C2C=C1.
What is the CAS number of 2-Isopropenylnaphthalene?
The CAS number of 2-Isopropenylnaphthalene is 3710-23-4.
Is 2-Isopropenylnaphthalene canonicalized?
Yes, 2-Isopropenylnaphthalene is canonicalized.