What is the molecular formula of 2-Isobutoxyacetic acid?
The molecular formula of 2-Isobutoxyacetic acid is C6H12O3.
What is the molecular weight of 2-Isobutoxyacetic acid?
The molecular weight of 2-Isobutoxyacetic acid is 132.16 g/mol.
What is the IUPAC name of 2-Isobutoxyacetic acid?
The IUPAC name of 2-Isobutoxyacetic acid is 2-(2-methylpropoxy)acetic acid.
What is the InChI of 2-Isobutoxyacetic acid?
The InChI of 2-Isobutoxyacetic acid is InChI=1S/C6H12O3/c1-5(2)3-9-4-6(7)8/h5H,3-4H2,1-2H3,(H,7,8).
What is the InChIKey of 2-Isobutoxyacetic acid?
The InChIKey of 2-Isobutoxyacetic acid is RJZXMJIGAJFDRS-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Isobutoxyacetic acid?
The canonical SMILES of 2-Isobutoxyacetic acid is CC(C)COCC(=O)O.
What is the CAS number of 2-Isobutoxyacetic acid?
The CAS number of 2-Isobutoxyacetic acid is 24133-46-8.
What is the European Community (EC) number of 2-Isobutoxyacetic acid?
The European Community (EC) number of 2-Isobutoxyacetic acid is 874-965-9.
What is the XLogP3-AA value of 2-Isobutoxyacetic acid?
The XLogP3-AA value of 2-Isobutoxyacetic acid is 1.
Is 2-Isobutoxyacetic acid a canonicalized compound?
Yes, 2-Isobutoxyacetic acid is a canonicalized compound.