What is the molecular formula of 2-Hydroxyquinoline?
The molecular formula of 2-Hydroxyquinoline is C9H7NO.
What is the molecular weight of 2-Hydroxyquinoline?
The molecular weight of 2-Hydroxyquinoline is 145.16 g/mol.
What is another name for 2-Hydroxyquinoline?
Another name for 2-Hydroxyquinoline is Quinolin-2-ol.
Is 2-Hydroxyquinoline a natural product?
Yes, 2-Hydroxyquinoline is a natural product found in Houttuynia cordata, Aconitum ferox, and Glycosmis pentaphylla.
What is the IUPAC name of 2-Hydroxyquinoline?
The IUPAC name of 2-Hydroxyquinoline is 1H-quinolin-2-one.
What is the Canonical SMILES of 2-Hydroxyquinoline?
The Canonical SMILES of 2-Hydroxyquinoline is C1=CC=C2C(=C1)C=CC(=O)N2.
What is the InChIKey of 2-Hydroxyquinoline?
The InChIKey of 2-Hydroxyquinoline is LISFMEBWQUVKPJ-UHFFFAOYSA-N.
What is the CAS number of 2-Hydroxyquinoline?
The CAS number of 2-Hydroxyquinoline is 59-31-4.
How many hydrogen bond donor counts does 2-Hydroxyquinoline have?
2-Hydroxyquinoline has 1 hydrogen bond donor count.
What is the topological polar surface area of 2-Hydroxyquinoline?
The topological polar surface area of 2-Hydroxyquinoline is 29.1 ?2.