What is the molecular formula of 2-Hydroxyethyl myristate?
The molecular formula of 2-Hydroxyethyl myristate is C16H32O3.
What are the synonyms for 2-Hydroxyethyl myristate?
The synonyms for 2-Hydroxyethyl myristate are 2-Hydroxyethyl tetradecanoate, Glycol myristate, and Tetradecanoic acid, 2-hydroxyethyl ester.
What is the molecular weight of 2-Hydroxyethyl myristate?
The molecular weight of 2-Hydroxyethyl myristate is 272.42 g/mol.
When was 2-Hydroxyethyl myristate created and modified?
2-Hydroxyethyl myristate was created on 2005-03-26 and modified on 2023-10-21.
What is the IUPAC name of 2-Hydroxyethyl myristate?
The IUPAC name of 2-Hydroxyethyl myristate is 2-hydroxyethyl tetradecanoate.
What is the InChI of 2-Hydroxyethyl myristate?
The InChI of 2-Hydroxyethyl myristate is InChI=1S/C16H32O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-16(18)19-15-14-17/h17H,2-15H2,1H3.
What is the InChIKey of 2-Hydroxyethyl myristate?
The InChIKey of 2-Hydroxyethyl myristate is ABFWOTZXBYVPIF-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Hydroxyethyl myristate?
The canonical SMILES of 2-Hydroxyethyl myristate is CCCCCCCCCCCCCC(=O)OCCO.
What is the CAS number of 2-Hydroxyethyl myristate?
The CAS number of 2-Hydroxyethyl myristate is 22122-18-5.
What is the XLogP3-AA value of 2-Hydroxyethyl myristate?
The XLogP3-AA value of 2-Hydroxyethyl myristate is 5.7.