What is the molecular formula of 2-Hydroxyethyl 2,4-dihydroxybenzoate?
The molecular formula of 2-Hydroxyethyl 2,4-dihydroxybenzoate is C9H10O5.
What are the synonyms of 2-Hydroxyethyl 2,4-dihydroxybenzoate?
The synonyms of 2-Hydroxyethyl 2,4-dihydroxybenzoate are 2,4-Dihydroxybenzoic Acid 2-Hydroxyethyl Ester and Benzoic acid, 2,4-dihydroxy-, 2-hydroxyethyl ester.
What is the molecular weight of 2-Hydroxyethyl 2,4-dihydroxybenzoate?
The molecular weight of 2-Hydroxyethyl 2,4-dihydroxybenzoate is 198.17 g/mol.
What is the IUPAC name of 2-Hydroxyethyl 2,4-dihydroxybenzoate?
The IUPAC name of 2-Hydroxyethyl 2,4-dihydroxybenzoate is 2-hydroxyethyl 2,4-dihydroxybenzoate.
What is the InChI of 2-Hydroxyethyl 2,4-dihydroxybenzoate?
The InChI of 2-Hydroxyethyl 2,4-dihydroxybenzoate is "InChI=1S/C9H10O5/c10-3-4-14-9(13)7-2-1-6(11)5-8(7)12/h1-2,5,10-12H,3-4H2".
What is the InChIKey of 2-Hydroxyethyl 2,4-dihydroxybenzoate?
The InChIKey of 2-Hydroxyethyl 2,4-dihydroxybenzoate is "GYMSXVSHWCOJEJ-UHFFFAOYSA-N".
What is the canonical SMILES of 2-Hydroxyethyl 2,4-dihydroxybenzoate?
The canonical SMILES of 2-Hydroxyethyl 2,4-dihydroxybenzoate is "C1=CC(=C(C=C1O)O)C(=O)OCCO".
What is the XLogP3 value of 2-Hydroxyethyl 2,4-dihydroxybenzoate?
The XLogP3 value of 2-Hydroxyethyl 2,4-dihydroxybenzoate is 1.3.
How many hydrogen bond donor counts does 2-Hydroxyethyl 2,4-dihydroxybenzoate have?
2-Hydroxyethyl 2,4-dihydroxybenzoate has 3 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does 2-Hydroxyethyl 2,4-dihydroxybenzoate have?
2-Hydroxyethyl 2,4-dihydroxybenzoate has 5 hydrogen bond acceptor counts.
※ Please kindly note that our products are for research use only.