What is the molecular formula of (2-Formylphenoxy)acetonitrile according to PubChem CID 3863749?
The molecular formula of (2-Formylphenoxy)acetonitrile is C9H7NO2.
What are the synonyms for (2-Formylphenoxy)acetonitrile?
The synonyms for (2-Formylphenoxy)acetonitrile are (2-formylphenoxy)acetonitrile 125418-83-9, 2-(2-formylphenoxy)acetonitrile, and (2-formylphenoxy)acetonitrile(SALTDATA: FREE).
What is the molecular weight of (2-Formylphenoxy)acetonitrile?
The molecular weight of (2-Formylphenoxy)acetonitrile is 161.16 g/mol.
When was (2-Formylphenoxy)acetonitrile created and modified?
(2-Formylphenoxy)acetonitrile was created on 2005-09-12 and was last modified on 2023-11-25.
What is the IUPAC name of (2-Formylphenoxy)acetonitrile?
The IUPAC name of (2-Formylphenoxy)acetonitrile is 2-(2-formylphenoxy)acetonitrile.
What is the InChI of (2-Formylphenoxy)acetonitrile?
The InChI of (2-Formylphenoxy)acetonitrile is InChI=1S/C9H7NO2/c10-5-6-12-9-4-2-1-3-8(9)7-11/h1-4,7H,6H2.
What is the InChIKey of (2-Formylphenoxy)acetonitrile?
The InChIKey of (2-Formylphenoxy)acetonitrile is YHZIVCGNCKDLCF-UHFFFAOYSA-N.
What is the canonical SMILES of (2-Formylphenoxy)acetonitrile?
The canonical SMILES of (2-Formylphenoxy)acetonitrile is C1=CC=C(C(=C1)C=O)OCC#N.
What is the CAS number of (2-Formylphenoxy)acetonitrile?
The CAS number of (2-Formylphenoxy)acetonitrile is 125418-83-9.
What is the XLogP3 value of (2-Formylphenoxy)acetonitrile?
The XLogP3 value of (2-Formylphenoxy)acetonitrile is 1.5.
※ Please kindly note that our products are for research use only.