--- Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C10H10O5.
The molecular weight of the compound is 210.18 g/mol.
The IUPAC name of the compound is 2-formyl-4,5-dimethoxybenzoic acid.
The InChI key of the compound is CXANNUKKXKKTKG-UHFFFAOYSA-N.
The canonical SMILES of the compound is COC1=C(C=C(C(=C1)C=O)C(=O)O)OC.
The CAS number of the compound is 490-63-1.
The XLogP3-AA value of the compound is 0.9.
The compound has 1 hydrogen bond donor count.
The compound has 5 hydrogen bond acceptor counts.
The compound has 4 rotatable bond counts.
Download
×