What is the molecular formula of 2'-Fluoroacetophenone?
The molecular formula of 2'-Fluoroacetophenone is C8H7FO.
What is the molecular weight of 2'-Fluoroacetophenone?
The molecular weight of 2'-Fluoroacetophenone is 138.14 g/mol.
What is the IUPAC name of 2'-Fluoroacetophenone?
The IUPAC name of 2'-Fluoroacetophenone is 2-fluoro-1-phenylethanone.
What is the InChI of 2'-Fluoroacetophenone?
The InChI of 2'-Fluoroacetophenone is InChI=1S/C8H7FO/c9-6-8(10)7-4-2-1-3-5-7/h1-5H,6H2.
What is the InChIKey of 2'-Fluoroacetophenone?
The InChIKey of 2'-Fluoroacetophenone is YOMBUJAFGMOIGS-UHFFFAOYSA-N.
What is the canonical SMILES of 2'-Fluoroacetophenone?
The canonical SMILES of 2'-Fluoroacetophenone is C1=CC=C(C=C1)C(=O)CF.
What is the CAS number of 2'-Fluoroacetophenone?
The CAS number of 2'-Fluoroacetophenone is 450-95-3.
What is the EC number of 2'-Fluoroacetophenone?
The EC number of 2'-Fluoroacetophenone is 207-190-6.
What is the XLogP3 value of 2'-Fluoroacetophenone?
The XLogP3 value of 2'-Fluoroacetophenone is 2.1.
Is 2'-Fluoroacetophenone a canonicalized compound?
Yes, 2'-Fluoroacetophenone is a canonicalized compound.