What is the PubChem CID of 2-Fluoro-6-iodotoluene?
PubChem CID 2774523
What is the molecular formula of 2-Fluoro-6-iodotoluene?
The molecular formula is C7H6FI.
What is the molecular weight of 2-Fluoro-6-iodotoluene?
The molecular weight is 236.02 g/mol.
When was 2-Fluoro-6-iodotoluene created in PubChem?
It was created on July 19, 2005.
When was 2-Fluoro-6-iodotoluene last modified in PubChem?
It was last modified on November 25, 2023.
What is the IUPAC name of 2-Fluoro-6-iodotoluene?
The IUPAC name is 1-fluoro-3-iodo-2-methylbenzene.
What is the InChI of 2-Fluoro-6-iodotoluene?
The InChI is InChI=1S/C7H6FI/c1-5-6(8)3-2-4-7(5)9/h2-4H,1H3.
What is the InChIKey of 2-Fluoro-6-iodotoluene?
The InChIKey is MSPXWJMFEVAKHQ-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Fluoro-6-iodotoluene?
The canonical SMILES is CC1=C(C=CC=C1I)F.
What is the CAS number of 2-Fluoro-6-iodotoluene?
The CAS number is 443-85-6.