What is the molecular formula of 2-Fluoro-5-iodotoluene?
The molecular formula of 2-Fluoro-5-iodotoluene is C7H6FI.
What is the molecular weight of 2-Fluoro-5-iodotoluene?
The molecular weight of 2-Fluoro-5-iodotoluene is 236.02 g/mol.
What is the IUPAC name of 2-Fluoro-5-iodotoluene?
The IUPAC name of 2-Fluoro-5-iodotoluene is 1-fluoro-4-iodo-2-methylbenzene.
What is the InChI of 2-Fluoro-5-iodotoluene?
The InChI of 2-Fluoro-5-iodotoluene is InChI=1S/C7H6FI/c1-5-4-6(9)2-3-7(5)8/h2-4H,1H3.
What is the InChIKey of 2-Fluoro-5-iodotoluene?
The InChIKey of 2-Fluoro-5-iodotoluene is DYQIYXDSKUUZRI-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Fluoro-5-iodotoluene?
The canonical SMILES of 2-Fluoro-5-iodotoluene is CC1=C(C=CC(=C1)I)F.
What is the CAS number of 2-Fluoro-5-iodotoluene?
The CAS number of 2-Fluoro-5-iodotoluene is 452-68-6.
What is the European Community (EC) number of 2-Fluoro-5-iodotoluene?
The European Community (EC) number of 2-Fluoro-5-iodotoluene is 207-206-1.
What is the XLogP3-AA value of 2-Fluoro-5-iodotoluene?
The XLogP3-AA value of 2-Fluoro-5-iodotoluene is 3.
Is 2-Fluoro-5-iodotoluene a canonicalized compound?
Yes, 2-Fluoro-5-iodotoluene is canonicalized.