The PubChem CID number for the compound is 45789844.
What is the molecular formula of the compound?
The molecular formula of the compound is C8H8BFO4.
What are the synonyms for the compound?
The synonyms for the compound are 1315476-07-3, 2-Fluoro-3-(methoxycarbonyl)phenylboronic acid, (2-Fluoro-3-(methoxycarbonyl)phenyl)boronic acid, [2-FLUORO-3-(METHOXYCARBONYL)PHENYL]BORONIC ACID, and 2-Fluoro-3-methoxycarbonylphenylboronic acid.
What is the molecular weight of the compound?
The molecular weight of the compound is 197.96 g/mol.
When was the compound created and last modified?
The compound was created on June 21, 2010, and last modified on December 2, 2023.
What is the IUPAC name of the compound?
The IUPAC name of the compound is (2-fluoro-3-methoxycarbonylphenyl)boronic acid.
What is the InChI of the compound?
The InChI of the compound is InChI=1S/C8H8BFO4/c1-14-8(11)5-3-2-4-6(7(5)10)9(12)13/h2-4,12-13H,1H3.
What is the InChIKey of the compound?
The InChIKey of the compound is ZWNQFICBQZRXEB-UHFFFAOYSA-N.
What is the canonical SMILES of the compound?
The canonical SMILES of the compound is B(C1=C(C(=CC=C1)C(=O)OC)F)(O)O.
What is the CAS number of the compound?
The CAS number of the compound is 1315476-07-3.
※ Please kindly note that our products are for research use only.